C19H33Cl2N3O — CID 119835872
N-[[4-(diethylaminomethyl)phenyl]methyl]-2-piperidin-4-ylacetamide;dihydrochloride (PubChem CID 119835872) has the molecular formula C19H33Cl2N3O and a molecular weight of 390.40 g/mol. Its IUPAC name is N-[[4-(diethylaminomethyl)phenyl]methyl]-2-piperidin-4-ylacetamide;dihydrochloride.
| Compound Name | N-[[4-(diethylaminomethyl)phenyl]methyl]-2-piperidin-4-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119835872 |
| Molecular Formula | C19H33Cl2N3O |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-[[4-(diethylaminomethyl)phenyl]methyl]-2-piperidin-4-ylacetamide;dihydrochloride |
| SMILES | CCN(CC)Cc1ccc(CNC(=O)CC2CCNCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C19H31N3O.2ClH/c1-3-22(4-2)15-18-7-5-17(6-8-18)14-21-19(23)13-16-9-11-20-12-10-16;;/h5-8,16,20H,3-4,9-15H2,1-2H3,(H,21,23);2*1H |
| InChIKey | ZBJFORUIZIGRKV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |