C43H43BFNO5 — CID 11983594
(3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-phenyl-4-[2-phenylmethoxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]azetidin-2-one (PubChem CID 11983594) has the molecular formula C43H43BFNO5 and a molecular weight of 683.63 g/mol. Its IUPAC name is (3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-phenyl-4-[2-phenylmethoxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]azetidin-2-one.
| Compound Name | (3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-phenyl-4-[2-phenylmethoxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 11983594 |
| Molecular Formula | C43H43BFNO5 |
| Molecular Weight | 683.63 g/mol |
| Exact Mass | 683.32 |
| IUPAC Name | (3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-1-phenyl-4-[2-phenylmethoxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]azetidin-2-one |
| SMILES | CC1(C)OB(c2ccc(-c3ccc([C@@H]4[C@@H](CC[C@H](O)c5ccc(F)cc5)C(=O)N4c4ccccc4)c(OCc4ccccc4)c3)cc2)OC1(C)C |
| InChI | InChI=1S/C43H43BFNO5/c1-42(2)43(3,4)51-44(50-42)33-20-15-30(16-21-33)32-19-24-36(39(27-32)49-28-29-11-7-5-8-12-29)40-37(41(48)46(40)35-13-9-6-10-14-35)25-26-38(47)31-17-22-34(45)23-18-31/h5-24,27,37-38,40,47H,25-26,28H2,1-4H3/t37-,38+,40-/m1/s1 |
| InChIKey | IJPGOTTVTRAFIO-FCHQCLMOSA-N |
| XLogP | 8.59 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.63 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|