C17H27Cl2N3O3 — CID 119836475
N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]morpholine-2-carboxamide;dihydrochloride (PubChem CID 119836475) has the molecular formula C17H27Cl2N3O3 and a molecular weight of 392.33 g/mol. Its IUPAC name is N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]morpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]morpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119836475 |
| Molecular Formula | C17H27Cl2N3O3 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]morpholine-2-carboxamide;dihydrochloride |
| SMILES | CN(Cc1ccccc1N1CCOCC1)C(=O)C1CNCCO1.Cl.Cl |
| InChI | InChI=1S/C17H25N3O3.2ClH/c1-19(17(21)16-12-18-6-9-23-16)13-14-4-2-3-5-15(14)20-7-10-22-11-8-20;;/h2-5,16,18H,6-13H2,1H3;2*1H |
| InChIKey | QTTXDFKENXPFLT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |