C19H27Cl2N5O — CID 119837058
(3-aminophenyl)-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone;dihydrochloride (PubChem CID 119837058) has the molecular formula C19H27Cl2N5O and a molecular weight of 412.37 g/mol. Its IUPAC name is (3-aminophenyl)-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | (3-aminophenyl)-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119837058 |
| Molecular Formula | C19H27Cl2N5O |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (3-aminophenyl)-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone;dihydrochloride |
| SMILES | Cc1cc(N2CCN(C(=O)c3cccc(N)c3)CC2)nc(C(C)C)n1.Cl.Cl |
| InChI | InChI=1S/C19H25N5O.2ClH/c1-13(2)18-21-14(3)11-17(22-18)23-7-9-24(10-8-23)19(25)15-5-4-6-16(20)12-15;;/h4-6,11-13H,7-10,20H2,1-3H3;2*1H |
| InChIKey | RAQOVMFIYSDIIS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|