C15H25Cl2N3O — CID 119837587
(2S)-2-amino-1-[4-(3-methylphenyl)piperazin-1-yl]butan-1-one;dihydrochloride (PubChem CID 119837587) has the molecular formula C15H25Cl2N3O and a molecular weight of 334.29 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-(3-methylphenyl)piperazin-1-yl]butan-1-one;dihydrochloride.
| Compound Name | (2S)-2-amino-1-[4-(3-methylphenyl)piperazin-1-yl]butan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119837587 |
| Molecular Formula | C15H25Cl2N3O |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (2S)-2-amino-1-[4-(3-methylphenyl)piperazin-1-yl]butan-1-one;dihydrochloride |
| SMILES | CC[C@H](N)C(=O)N1CCN(c2cccc(C)c2)CC1.Cl.Cl |
| InChI | InChI=1S/C15H23N3O.2ClH/c1-3-14(16)15(19)18-9-7-17(8-10-18)13-6-4-5-12(2)11-13;;/h4-6,11,14H,3,7-10,16H2,1-2H3;2*1H/t14-;;/m0../s1 |
| InChIKey | CUHCMTQUBKEICH-UTLKBRERSA-N |
| XLogP | 2.22 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |