About [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl 2,2-dimethylpropanoate
[5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11983863) has the molecular formula C16H22O6
and a molecular weight of 310.35 g/mol. Its IUPAC name is [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl 2,2-dimethylpropanoate |
| PubChem CID | 11983863 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1cc(=O)c(OC(=O)C(C)(C)C)co1 |
| InChI | InChI=1S/C16H22O6/c1-15(2,3)13(18)21-8-10-7-11(17)12(9-20-10)22-14(19)16(4,5)6/h7,9H,8H2,1-6H3 |
| InChIKey | GFQJNMAZHWYPCH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl 2,2-dimethylpropanoate?
The IUPAC name of [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl 2,2-dimethylpropanoate (CID 11983863) is [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl 2,2-dimethylpropanoate.
What is the SMILES notation for [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl 2,2-dimethylpropanoate?
The canonical SMILES for [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OCc1cc(=O)c(OC(=O)C(C)(C)C)co1.
What is the InChIKey of [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl 2,2-dimethylpropanoate?
The InChIKey is GFQJNMAZHWYPCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O6/c1-15(2,3)13(18)21-8-10-7-11(17)12(9-20-10)22-14(19)16(4,5)6/h7,9H,8H2,1-6H3.
What are the key properties of [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl 2,2-dimethylpropanoate?
[5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl 2,2-dimethylpropanoate has a molecular weight of 310.35 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 11983863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).