C21H29Cl2N3OS — CID 119838685
3-piperidin-3-yl-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]butanamide;dihydrochloride (PubChem CID 119838685) has the molecular formula C21H29Cl2N3OS and a molecular weight of 442.46 g/mol. Its IUPAC name is 3-piperidin-3-yl-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]butanamide;dihydrochloride.
| Compound Name | 3-piperidin-3-yl-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119838685 |
| Molecular Formula | C21H29Cl2N3OS |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 3-piperidin-3-yl-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]butanamide;dihydrochloride |
| SMILES | CC(CC(=O)Nc1ccc(SCc2cccnc2)cc1)C1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C21H27N3OS.2ClH/c1-16(18-5-3-11-23-14-18)12-21(25)24-19-6-8-20(9-7-19)26-15-17-4-2-10-22-13-17;;/h2,4,6-10,13,16,18,23H,3,5,11-12,14-15H2,1H3,(H,24,25);2*1H |
| InChIKey | BLQCOABFXMEBFW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |