C15H25Cl2N7O — CID 119840099
4-(methylamino)-1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]butan-1-one;dihydrochloride (PubChem CID 119840099) has the molecular formula C15H25Cl2N7O and a molecular weight of 390.32 g/mol. Its IUPAC name is 4-(methylamino)-1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]butan-1-one;dihydrochloride.
| Compound Name | 4-(methylamino)-1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]butan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119840099 |
| Molecular Formula | C15H25Cl2N7O |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 4-(methylamino)-1-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]butan-1-one;dihydrochloride |
| SMILES | CNCCCC(=O)N1CCN(c2ncnc3c2cnn3C)CC1.Cl.Cl |
| InChI | InChI=1S/C15H23N7O.2ClH/c1-16-5-3-4-13(23)21-6-8-22(9-7-21)15-12-10-19-20(2)14(12)17-11-18-15;;/h10-11,16H,3-9H2,1-2H3;2*1H |
| InChIKey | BNWINCMDAFCDRU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|