C18H22O5S2 — CID 11984153
[(5R,7R,8S)-5-methoxy-8-phenylmethoxy-3,5,7,8-tetrahydro-2H-[1,4]dithiino[2,3-c]pyran-7-yl]methyl acetate (PubChem CID 11984153) has the molecular formula C18H22O5S2 and a molecular weight of 382.50 g/mol. Its IUPAC name is [(5R,7R,8S)-5-methoxy-8-phenylmethoxy-3,5,7,8-tetrahydro-2H-[1,4]dithiino[2,3-c]pyran-7-yl]methyl acetate.
| Compound Name | [(5R,7R,8S)-5-methoxy-8-phenylmethoxy-3,5,7,8-tetrahydro-2H-[1,4]dithiino[2,3-c]pyran-7-yl]methyl acetate |
|---|---|
| PubChem CID | 11984153 |
| Molecular Formula | C18H22O5S2 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | [(5R,7R,8S)-5-methoxy-8-phenylmethoxy-3,5,7,8-tetrahydro-2H-[1,4]dithiino[2,3-c]pyran-7-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H](COC(C)=O)[C@H](OCc2ccccc2)C2=C1SCCS2 |
| InChI | InChI=1S/C18H22O5S2/c1-12(19)21-11-14-15(22-10-13-6-4-3-5-7-13)16-17(18(20-2)23-14)25-9-8-24-16/h3-7,14-15,18H,8-11H2,1-2H3/t14-,15+,18-/m1/s1 |
| InChIKey | QKGBBVDUCXAZHN-RVKKMQEKSA-N |
| XLogP | 3.20 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |