C18H26Cl2FN5O2 — CID 119841789
N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride (PubChem CID 119841789) has the molecular formula C18H26Cl2FN5O2 and a molecular weight of 434.34 g/mol. Its IUPAC name is N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride.
| Compound Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119841789 |
| Molecular Formula | C18H26Cl2FN5O2 |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride |
| SMILES | COCCNCC(=O)Nc1cc(-c2nnc3n2CCCCC3)ccc1F.Cl.Cl |
| InChI | InChI=1S/C18H24FN5O2.2ClH/c1-26-10-8-20-12-17(25)21-15-11-13(6-7-14(15)19)18-23-22-16-5-3-2-4-9-24(16)18;;/h6-7,11,20H,2-5,8-10,12H2,1H3,(H,21,25);2*1H |
| InChIKey | ZPFMGJAHXVXEPF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|