C15H23Cl2N5O2S — CID 119842629
2-(2-methoxyethylamino)-1-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanone;dihydrochloride (PubChem CID 119842629) has the molecular formula C15H23Cl2N5O2S and a molecular weight of 408.36 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-1-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanone;dihydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-1-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 119842629 |
| Molecular Formula | C15H23Cl2N5O2S |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 2-(2-methoxyethylamino)-1-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanone;dihydrochloride |
| SMILES | COCCNCC(=O)N1CCN(c2ncnc3sccc23)CC1.Cl.Cl |
| InChI | InChI=1S/C15H21N5O2S.2ClH/c1-22-8-3-16-10-13(21)19-4-6-20(7-5-19)14-12-2-9-23-15(12)18-11-17-14;;/h2,9,11,16H,3-8,10H2,1H3;2*1H |
| InChIKey | LNTVMPTVPMFXSW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|