C13H27Cl2N3O3 — CID 119843322
[4-(2-ethoxyethyl)piperazin-1-yl]-(4-hydroxypyrrolidin-2-yl)methanone;dihydrochloride (PubChem CID 119843322) has the molecular formula C13H27Cl2N3O3 and a molecular weight of 344.28 g/mol. Its IUPAC name is [4-(2-ethoxyethyl)piperazin-1-yl]-(4-hydroxypyrrolidin-2-yl)methanone;dihydrochloride.
| Compound Name | [4-(2-ethoxyethyl)piperazin-1-yl]-(4-hydroxypyrrolidin-2-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119843322 |
| Molecular Formula | C13H27Cl2N3O3 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [4-(2-ethoxyethyl)piperazin-1-yl]-(4-hydroxypyrrolidin-2-yl)methanone;dihydrochloride |
| SMILES | CCOCCN1CCN(C(=O)C2CC(O)CN2)CC1.Cl.Cl |
| InChI | InChI=1S/C13H25N3O3.2ClH/c1-2-19-8-7-15-3-5-16(6-4-15)13(18)12-9-11(17)10-14-12;;/h11-12,14,17H,2-10H2,1H3;2*1H |
| InChIKey | IHBWATOFVHYXMQ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|