C45H32N6O11 — CID 11984338
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(dibenzoylamino)-2-nitropurin-9-yl]oxolan-2-yl]methyl benzoate (PubChem CID 11984338) has the molecular formula C45H32N6O11 and a molecular weight of 832.78 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(dibenzoylamino)-2-nitropurin-9-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(dibenzoylamino)-2-nitropurin-9-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11984338 |
| Molecular Formula | C45H32N6O11 |
| Molecular Weight | 832.78 g/mol |
| Exact Mass | 832.21 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(dibenzoylamino)-2-nitropurin-9-yl]oxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](n2cnc3c(N(C(=O)c4ccccc4)C(=O)c4ccccc4)nc([N+](=O)[O-])nc32)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H32N6O11/c52-39(28-16-6-1-7-17-28)50(40(53)29-18-8-2-9-19-29)38-34-37(47-45(48-38)51(57)58)49(27-46-34)41-36(62-44(56)32-24-14-5-15-25-32)35(61-43(55)31-22-12-4-13-23-31)33(60-41)26-59-42(54)30-20-10-3-11-21-30/h1-25,27,33,35-36,41H,26H2/t33-,35-,36-,41-/m1/s1 |
| InChIKey | MAXTWGKOODDSCR-WCMBYXODSA-N |
| XLogP | 6.43 |
| TPSA | 212.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.78 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|