C45H32FN5O9 — CID 11984339
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(dibenzoylamino)-2-fluoropurin-9-yl]oxolan-2-yl]methyl benzoate (PubChem CID 11984339) has the molecular formula C45H32FN5O9 and a molecular weight of 805.78 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(dibenzoylamino)-2-fluoropurin-9-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(dibenzoylamino)-2-fluoropurin-9-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11984339 |
| Molecular Formula | C45H32FN5O9 |
| Molecular Weight | 805.78 g/mol |
| Exact Mass | 805.22 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-[6-(dibenzoylamino)-2-fluoropurin-9-yl]oxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](n2cnc3c(N(C(=O)c4ccccc4)C(=O)c4ccccc4)nc(F)nc32)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H32FN5O9/c46-45-48-37-34(38(49-45)51(39(52)28-16-6-1-7-17-28)40(53)29-18-8-2-9-19-29)47-27-50(37)41-36(60-44(56)32-24-14-5-15-25-32)35(59-43(55)31-22-12-4-13-23-31)33(58-41)26-57-42(54)30-20-10-3-11-21-30/h1-25,27,33,35-36,41H,26H2/t33-,35-,36-,41-/m1/s1 |
| InChIKey | VUFNAMSWEZVCDF-WCMBYXODSA-N |
| XLogP | 6.66 |
| TPSA | 169.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.78 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|