C14H23Cl2N3O2 — CID 119843667
N-[2-(dimethylamino)phenyl]-2-morpholin-2-ylacetamide;dihydrochloride (PubChem CID 119843667) has the molecular formula C14H23Cl2N3O2 and a molecular weight of 336.26 g/mol. Its IUPAC name is N-[2-(dimethylamino)phenyl]-2-morpholin-2-ylacetamide;dihydrochloride.
| Compound Name | N-[2-(dimethylamino)phenyl]-2-morpholin-2-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119843667 |
| Molecular Formula | C14H23Cl2N3O2 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-[2-(dimethylamino)phenyl]-2-morpholin-2-ylacetamide;dihydrochloride |
| SMILES | CN(C)c1ccccc1NC(=O)CC1CNCCO1.Cl.Cl |
| InChI | InChI=1S/C14H21N3O2.2ClH/c1-17(2)13-6-4-3-5-12(13)16-14(18)9-11-10-15-7-8-19-11;;/h3-6,11,15H,7-10H2,1-2H3,(H,16,18);2*1H |
| InChIKey | GQTGVIOZLSXXIK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |