About 2-[4-(2-amino-3-phenylpropanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide
2-[4-(2-amino-3-phenylpropanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide (PubChem CID 119844043) has the molecular formula C20H32N4O2
and a molecular weight of 360.50 g/mol. Its IUPAC name is 2-[4-(2-amino-3-phenylpropanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-[4-(2-amino-3-phenylpropanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide |
| PubChem CID | 119844043 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 2-[4-(2-amino-3-phenylpropanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1CCCN(C(=O)C(N)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H32N4O2/c1-3-23(4-2)19(25)16-22-11-8-12-24(14-13-22)20(26)18(21)15-17-9-6-5-7-10-17/h5-7,9-10,18H,3-4,8,11-16,21H2,1-2H3 |
| InChIKey | QUGBGOFOHRSHEX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(2-amino-3-phenylpropanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-amino-3-phenylpropanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide?
The IUPAC name of 2-[4-(2-amino-3-phenylpropanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide (CID 119844043) is 2-[4-(2-amino-3-phenylpropanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide.
What is the SMILES notation for 2-[4-(2-amino-3-phenylpropanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide?
The canonical SMILES for 2-[4-(2-amino-3-phenylpropanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide is CCN(CC)C(=O)CN1CCCN(C(=O)C(N)Cc2ccccc2)CC1.
What is the InChIKey of 2-[4-(2-amino-3-phenylpropanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide?
The InChIKey is QUGBGOFOHRSHEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32N4O2/c1-3-23(4-2)19(25)16-22-11-8-12-24(14-13-22)20(26)18(21)15-17-9-6-5-7-10-17/h5-7,9-10,18H,3-4,8,11-16,21H2,1-2H3.
What are the key properties of 2-[4-(2-amino-3-phenylpropanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide?
2-[4-(2-amino-3-phenylpropanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide has a molecular weight of 360.50 g/mol, XLogP of 0.96, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-amino-3-phenylpropanoyl)-1,4-diazepan-1-yl]-N,N-diethylacetamide is sourced from PubChem (CID 119844043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).