C32H52N2O5S — CID 11984545
[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(3S)-1-[(2R)-2-amino-3-methylbutanoyl]piperidin-3-yl]sulfanylacetate (PubChem CID 11984545) has the molecular formula C32H52N2O5S and a molecular weight of 576.84 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(3S)-1-[(2R)-2-amino-3-methylbutanoyl]piperidin-3-yl]sulfanylacetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(3S)-1-[(2R)-2-amino-3-methylbutanoyl]piperidin-3-yl]sulfanylacetate |
|---|---|
| PubChem CID | 11984545 |
| Molecular Formula | C32H52N2O5S |
| Molecular Weight | 576.84 g/mol |
| Exact Mass | 576.36 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(3S)-1-[(2R)-2-amino-3-methylbutanoyl]piperidin-3-yl]sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CS[C@H]2CCCN(C(=O)[C@H](N)C(C)C)C2)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C32H52N2O5S/c1-8-30(6)16-24(31(7)20(4)11-13-32(21(5)28(30)37)14-12-23(35)27(31)32)39-25(36)18-40-22-10-9-15-34(17-22)29(38)26(33)19(2)3/h8,19-22,24,26-28,37H,1,9-18,33H2,2-7H3/t20-,21+,22+,24-,26-,27+,28+,30-,31+,32+/m1/s1 |
| InChIKey | AFYOQRIZFPJUAR-KOBPMBMUSA-N |
| XLogP | 4.60 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.84 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|