C16H24N4O2 — CID 119846618
N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]pyrrolidine-3-carboxamide (PubChem CID 119846618) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]pyrrolidine-3-carboxamide.
| Compound Name | N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119846618 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]pyrrolidine-3-carboxamide |
| SMILES | CC1CN(c2ccc(CNC(=O)C3CCNC3)cn2)CCO1 |
| InChI | InChI=1S/C16H24N4O2/c1-12-11-20(6-7-22-12)15-3-2-13(8-18-15)9-19-16(21)14-4-5-17-10-14/h2-3,8,12,14,17H,4-7,9-11H2,1H3,(H,19,21) |
| InChIKey | IYSMIWYKVVTCHM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |