C13H19Cl2N5O — CID 119846827
N-(6-imidazol-1-yl-3-pyridinyl)-4-(methylamino)butanamide;dihydrochloride (PubChem CID 119846827) has the molecular formula C13H19Cl2N5O and a molecular weight of 332.24 g/mol. Its IUPAC name is N-(6-imidazol-1-yl-3-pyridinyl)-4-(methylamino)butanamide;dihydrochloride.
| Compound Name | N-(6-imidazol-1-yl-3-pyridinyl)-4-(methylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119846827 |
| Molecular Formula | C13H19Cl2N5O |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-(6-imidazol-1-yl-3-pyridinyl)-4-(methylamino)butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)Nc1ccc(-n2ccnc2)nc1.Cl.Cl |
| InChI | InChI=1S/C13H17N5O.2ClH/c1-14-6-2-3-13(19)17-11-4-5-12(16-9-11)18-8-7-15-10-18;;/h4-5,7-10,14H,2-3,6H2,1H3,(H,17,19);2*1H |
| InChIKey | KYPBQGYKTQXGSH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|