C16H23Cl2N5O — CID 119846913
3-amino-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]cyclohexane-1-carboxamide;dihydrochloride (PubChem CID 119846913) has the molecular formula C16H23Cl2N5O and a molecular weight of 372.30 g/mol. Its IUPAC name is 3-amino-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]cyclohexane-1-carboxamide;dihydrochloride.
| Compound Name | 3-amino-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]cyclohexane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119846913 |
| Molecular Formula | C16H23Cl2N5O |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 3-amino-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]cyclohexane-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC1CCCC(C(=O)NCc2ccnc(-n3cccn3)c2)C1 |
| InChI | InChI=1S/C16H21N5O.2ClH/c17-14-4-1-3-13(10-14)16(22)19-11-12-5-7-18-15(9-12)21-8-2-6-20-21;;/h2,5-9,13-14H,1,3-4,10-11,17H2,(H,19,22);2*1H |
| InChIKey | MWZGYQIXBHRHCA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |