About benzene;[cyclopenta-2,4-dien-1-yl(phenyl)methyl]benzene;tungsten
benzene;[cyclopenta-2,4-dien-1-yl(phenyl)methyl]benzene;tungsten (PubChem CID 11984790) has the molecular formula C24H20W-2
and a molecular weight of 492.26 g/mol. Its IUPAC name is benzene;[cyclopenta-2,4-dien-1-yl(phenyl)methyl]benzene;tungsten.
Molecular Properties
| Compound Name | benzene;[cyclopenta-2,4-dien-1-yl(phenyl)methyl]benzene;tungsten |
| PubChem CID | 11984790 |
| Molecular Formula | C24H20W-2 |
| Molecular Weight | 492.26 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | benzene;[cyclopenta-2,4-dien-1-yl(phenyl)methyl]benzene;tungsten |
| SMILES | [W].c1ccc([C-](c2ccccc2)[c-]2cccc2)cc1.c1ccccc1 |
| InChI | InChI=1S/C18H14.C6H6.W/c1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16;1-2-4-6-5-3-1;/h1-14H;1-6H;/q-2;; |
| InChIKey | YKHVQDQUKJCBFE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.26 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzene;[cyclopenta-2,4-dien-1-yl(phenyl)methyl]benzene;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;[cyclopenta-2,4-dien-1-yl(phenyl)methyl]benzene;tungsten?
The IUPAC name of benzene;[cyclopenta-2,4-dien-1-yl(phenyl)methyl]benzene;tungsten (CID 11984790) is benzene;[cyclopenta-2,4-dien-1-yl(phenyl)methyl]benzene;tungsten.
What is the SMILES notation for benzene;[cyclopenta-2,4-dien-1-yl(phenyl)methyl]benzene;tungsten?
The canonical SMILES for benzene;[cyclopenta-2,4-dien-1-yl(phenyl)methyl]benzene;tungsten is [W].c1ccc([C-](c2ccccc2)[c-]2cccc2)cc1.c1ccccc1.
What is the InChIKey of benzene;[cyclopenta-2,4-dien-1-yl(phenyl)methyl]benzene;tungsten?
The InChIKey is YKHVQDQUKJCBFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14.C6H6.W/c1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16;1-2-4-6-5-3-1;/h1-14H;1-6H;/q-2;;.
What are the key properties of benzene;[cyclopenta-2,4-dien-1-yl(phenyl)methyl]benzene;tungsten?
benzene;[cyclopenta-2,4-dien-1-yl(phenyl)methyl]benzene;tungsten has a molecular weight of 492.26 g/mol, XLogP of 6.11, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;[cyclopenta-2,4-dien-1-yl(phenyl)methyl]benzene;tungsten is sourced from PubChem (CID 11984790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).