C15H26Cl2N4O — CID 119848202
3-amino-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]butanamide;dihydrochloride (PubChem CID 119848202) has the molecular formula C15H26Cl2N4O and a molecular weight of 349.31 g/mol. Its IUPAC name is 3-amino-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]butanamide;dihydrochloride.
| Compound Name | 3-amino-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119848202 |
| Molecular Formula | C15H26Cl2N4O |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-amino-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]butanamide;dihydrochloride |
| SMILES | CC(N)CC(=O)NC1CCN(Cc2ccncc2)CC1.Cl.Cl |
| InChI | InChI=1S/C15H24N4O.2ClH/c1-12(16)10-15(20)18-14-4-8-19(9-5-14)11-13-2-6-17-7-3-13;;/h2-3,6-7,12,14H,4-5,8-11,16H2,1H3,(H,18,20);2*1H |
| InChIKey | KQMUHUIPRYJUNZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |