C19H27Cl2N5O — CID 119848273
N-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119848273) has the molecular formula C19H27Cl2N5O and a molecular weight of 412.37 g/mol. Its IUPAC name is N-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119848273 |
| Molecular Formula | C19H27Cl2N5O |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | Cc1nccn1-c1ccc(CNC(=O)C2CC3CCCCC3N2)cn1.Cl.Cl |
| InChI | InChI=1S/C19H25N5O.2ClH/c1-13-20-8-9-24(13)18-7-6-14(11-21-18)12-22-19(25)17-10-15-4-2-3-5-16(15)23-17;;/h6-9,11,15-17,23H,2-5,10,12H2,1H3,(H,22,25);2*1H |
| InChIKey | RFLLNNHALGOLHH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |