C18H25Cl2N3O2 — CID 119848997
2-amino-N-[2-(2,3-dimethylphenoxy)-3-pyridinyl]pentanamide;dihydrochloride (PubChem CID 119848997) has the molecular formula C18H25Cl2N3O2 and a molecular weight of 386.32 g/mol. Its IUPAC name is 2-amino-N-[2-(2,3-dimethylphenoxy)-3-pyridinyl]pentanamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-(2,3-dimethylphenoxy)-3-pyridinyl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 119848997 |
| Molecular Formula | C18H25Cl2N3O2 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-amino-N-[2-(2,3-dimethylphenoxy)-3-pyridinyl]pentanamide;dihydrochloride |
| SMILES | CCCC(N)C(=O)Nc1cccnc1Oc1cccc(C)c1C.Cl.Cl |
| InChI | InChI=1S/C18H23N3O2.2ClH/c1-4-7-14(19)17(22)21-15-9-6-11-20-18(15)23-16-10-5-8-12(2)13(16)3;;/h5-6,8-11,14H,4,7,19H2,1-3H3,(H,21,22);2*1H |
| InChIKey | KXZHSHHYFNIJPW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |