C20H26Cl2FN3O2 — CID 119849091
N-[6-(4-fluorophenoxy)-3-pyridinyl]-3-piperidin-3-ylbutanamide;dihydrochloride (PubChem CID 119849091) has the molecular formula C20H26Cl2FN3O2 and a molecular weight of 430.35 g/mol. Its IUPAC name is N-[6-(4-fluorophenoxy)-3-pyridinyl]-3-piperidin-3-ylbutanamide;dihydrochloride.
| Compound Name | N-[6-(4-fluorophenoxy)-3-pyridinyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119849091 |
| Molecular Formula | C20H26Cl2FN3O2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[6-(4-fluorophenoxy)-3-pyridinyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
| SMILES | CC(CC(=O)Nc1ccc(Oc2ccc(F)cc2)nc1)C1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C20H24FN3O2.2ClH/c1-14(15-3-2-10-22-12-15)11-19(25)24-17-6-9-20(23-13-17)26-18-7-4-16(21)5-8-18;;/h4-9,13-15,22H,2-3,10-12H2,1H3,(H,24,25);2*1H |
| InChIKey | ZWKLTQQBYHQBOR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |