C19H29FN4O3 — CID 119849290
(2S)-2-amino-N-[4-fluoro-3-(3-morpholin-4-ylpropanoylamino)phenyl]-4-methylpentanamide (PubChem CID 119849290) has the molecular formula C19H29FN4O3 and a molecular weight of 380.46 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-fluoro-3-(3-morpholin-4-ylpropanoylamino)phenyl]-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[4-fluoro-3-(3-morpholin-4-ylpropanoylamino)phenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 119849290 |
| Molecular Formula | C19H29FN4O3 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (2S)-2-amino-N-[4-fluoro-3-(3-morpholin-4-ylpropanoylamino)phenyl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)Nc1ccc(F)c(NC(=O)CCN2CCOCC2)c1 |
| InChI | InChI=1S/C19H29FN4O3/c1-13(2)11-16(21)19(26)22-14-3-4-15(20)17(12-14)23-18(25)5-6-24-7-9-27-10-8-24/h3-4,12-13,16H,5-11,21H2,1-2H3,(H,22,26)(H,23,25)/t16-/m0/s1 |
| InChIKey | JOVFMKFTPTYSEW-INIZCTEOSA-N |
| XLogP | 1.80 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |