C14H31Cl2N3O — CID 119852526
N-[4-(diethylamino)butyl]piperidine-4-carboxamide;dihydrochloride (PubChem CID 119852526) has the molecular formula C14H31Cl2N3O and a molecular weight of 328.33 g/mol. Its IUPAC name is N-[4-(diethylamino)butyl]piperidine-4-carboxamide;dihydrochloride.
| Compound Name | N-[4-(diethylamino)butyl]piperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119852526 |
| Molecular Formula | C14H31Cl2N3O |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-[4-(diethylamino)butyl]piperidine-4-carboxamide;dihydrochloride |
| SMILES | CCN(CC)CCCCNC(=O)C1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H29N3O.2ClH/c1-3-17(4-2)12-6-5-9-16-14(18)13-7-10-15-11-8-13;;/h13,15H,3-12H2,1-2H3,(H,16,18);2*1H |
| InChIKey | FBZZHMOOXSKULS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|