C15H31Cl2N3O2 — CID 119852622
4-hydroxy-N-[4-(2-methylpiperidin-1-yl)butyl]pyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 119852622) has the molecular formula C15H31Cl2N3O2 and a molecular weight of 356.34 g/mol. Its IUPAC name is 4-hydroxy-N-[4-(2-methylpiperidin-1-yl)butyl]pyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | 4-hydroxy-N-[4-(2-methylpiperidin-1-yl)butyl]pyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119852622 |
| Molecular Formula | C15H31Cl2N3O2 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 4-hydroxy-N-[4-(2-methylpiperidin-1-yl)butyl]pyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | CC1CCCCN1CCCCNC(=O)C1CC(O)CN1.Cl.Cl |
| InChI | InChI=1S/C15H29N3O2.2ClH/c1-12-6-2-4-8-18(12)9-5-3-7-16-15(20)14-10-13(19)11-17-14;;/h12-14,17,19H,2-11H2,1H3,(H,16,20);2*1H |
| InChIKey | KDHXUYQLHXMYMM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|