C17H29Cl2N3O — CID 119852810
2-amino-N-[3-(diethylaminomethyl)phenyl]cyclopentane-1-carboxamide;dihydrochloride (PubChem CID 119852810) has the molecular formula C17H29Cl2N3O and a molecular weight of 362.35 g/mol. Its IUPAC name is 2-amino-N-[3-(diethylaminomethyl)phenyl]cyclopentane-1-carboxamide;dihydrochloride.
| Compound Name | 2-amino-N-[3-(diethylaminomethyl)phenyl]cyclopentane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119852810 |
| Molecular Formula | C17H29Cl2N3O |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-amino-N-[3-(diethylaminomethyl)phenyl]cyclopentane-1-carboxamide;dihydrochloride |
| SMILES | CCN(CC)Cc1cccc(NC(=O)C2CCCC2N)c1.Cl.Cl |
| InChI | InChI=1S/C17H27N3O.2ClH/c1-3-20(4-2)12-13-7-5-8-14(11-13)19-17(21)15-9-6-10-16(15)18;;/h5,7-8,11,15-16H,3-4,6,9-10,12,18H2,1-2H3,(H,19,21);2*1H |
| InChIKey | MZEYAXKNEZGPCB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |