C12H19Cl2N3O — CID 119853598
N-[(6-methyl-3-pyridinyl)methyl]pyrrolidine-3-carboxamide;dihydrochloride (PubChem CID 119853598) has the molecular formula C12H19Cl2N3O and a molecular weight of 292.21 g/mol. Its IUPAC name is N-[(6-methyl-3-pyridinyl)methyl]pyrrolidine-3-carboxamide;dihydrochloride.
| Compound Name | N-[(6-methyl-3-pyridinyl)methyl]pyrrolidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119853598 |
| Molecular Formula | C12H19Cl2N3O |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-[(6-methyl-3-pyridinyl)methyl]pyrrolidine-3-carboxamide;dihydrochloride |
| SMILES | Cc1ccc(CNC(=O)C2CCNC2)cn1.Cl.Cl |
| InChI | InChI=1S/C12H17N3O.2ClH/c1-9-2-3-10(6-14-9)7-15-12(16)11-4-5-13-8-11;;/h2-3,6,11,13H,4-5,7-8H2,1H3,(H,15,16);2*1H |
| InChIKey | NCVNIIYGSHTYJV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |