C18H29Cl2N3O3 — CID 119853784
4-methoxy-N-[(2-morpholin-4-ylphenyl)methyl]piperidine-4-carboxamide;dihydrochloride (PubChem CID 119853784) has the molecular formula C18H29Cl2N3O3 and a molecular weight of 406.35 g/mol. Its IUPAC name is 4-methoxy-N-[(2-morpholin-4-ylphenyl)methyl]piperidine-4-carboxamide;dihydrochloride.
| Compound Name | 4-methoxy-N-[(2-morpholin-4-ylphenyl)methyl]piperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119853784 |
| Molecular Formula | C18H29Cl2N3O3 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 4-methoxy-N-[(2-morpholin-4-ylphenyl)methyl]piperidine-4-carboxamide;dihydrochloride |
| SMILES | COC1(C(=O)NCc2ccccc2N2CCOCC2)CCNCC1.Cl.Cl |
| InChI | InChI=1S/C18H27N3O3.2ClH/c1-23-18(6-8-19-9-7-18)17(22)20-14-15-4-2-3-5-16(15)21-10-12-24-13-11-21;;/h2-5,19H,6-14H2,1H3,(H,20,22);2*1H |
| InChIKey | BIAVQBNIYHHIJW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |