C14H22Cl2N4O — CID 119854046
3-amino-N-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]propanamide;dihydrochloride (PubChem CID 119854046) has the molecular formula C14H22Cl2N4O and a molecular weight of 333.26 g/mol. Its IUPAC name is 3-amino-N-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]propanamide;dihydrochloride.
| Compound Name | 3-amino-N-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119854046 |
| Molecular Formula | C14H22Cl2N4O |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 3-amino-N-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]propanamide;dihydrochloride |
| SMILES | CC(C)C(NC(=O)CCN)c1nc2ccccc2[nH]1.Cl.Cl |
| InChI | InChI=1S/C14H20N4O.2ClH/c1-9(2)13(18-12(19)7-8-15)14-16-10-5-3-4-6-11(10)17-14;;/h3-6,9,13H,7-8,15H2,1-2H3,(H,16,17)(H,18,19);2*1H |
| InChIKey | NIOIIEAXOQLXSD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |