C13H29Cl2N3O2 — CID 119855874
N-[1-(dimethylamino)-4-methylpentan-2-yl]morpholine-2-carboxamide;dihydrochloride (PubChem CID 119855874) has the molecular formula C13H29Cl2N3O2 and a molecular weight of 330.30 g/mol. Its IUPAC name is N-[1-(dimethylamino)-4-methylpentan-2-yl]morpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-[1-(dimethylamino)-4-methylpentan-2-yl]morpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119855874 |
| Molecular Formula | C13H29Cl2N3O2 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-[1-(dimethylamino)-4-methylpentan-2-yl]morpholine-2-carboxamide;dihydrochloride |
| SMILES | CC(C)CC(CN(C)C)NC(=O)C1CNCCO1.Cl.Cl |
| InChI | InChI=1S/C13H27N3O2.2ClH/c1-10(2)7-11(9-16(3)4)15-13(17)12-8-14-5-6-18-12;;/h10-12,14H,5-9H2,1-4H3,(H,15,17);2*1H |
| InChIKey | JPOIESLJYAQPTL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |