C15H25N3OS — CID 119856324
N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-4-(methylamino)butanamide (PubChem CID 119856324) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-4-(methylamino)butanamide.
| Compound Name | N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119856324 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)NCC(C)N1CCc2sccc2C1 |
| InChI | InChI=1S/C15H25N3OS/c1-12(10-17-15(19)4-3-7-16-2)18-8-5-14-13(11-18)6-9-20-14/h6,9,12,16H,3-5,7-8,10-11H2,1-2H3,(H,17,19) |
| InChIKey | RUHFFKGLAMTBFR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|