C21H31N5O2 — CID 119857095
7-amino-1-[4-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]heptan-1-one (PubChem CID 119857095) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 7-amino-1-[4-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]heptan-1-one.
| Compound Name | 7-amino-1-[4-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 119857095 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 7-amino-1-[4-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]heptan-1-one |
| SMILES | CC(c1nc(-c2ccccc2)no1)N1CCN(C(=O)CCCCCCN)CC1 |
| InChI | InChI=1S/C21H31N5O2/c1-17(21-23-20(24-28-21)18-9-5-4-6-10-18)25-13-15-26(16-14-25)19(27)11-7-2-3-8-12-22/h4-6,9-10,17H,2-3,7-8,11-16,22H2,1H3 |
| InChIKey | LBSHFLCYTPJICD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|