About cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanone;iron
cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanone;iron (PubChem CID 11985923) has the molecular formula C12H8FeO-6
and a molecular weight of 224.04 g/mol. Its IUPAC name is cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanone;iron.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanone;iron |
| PubChem CID | 11985923 |
| Molecular Formula | C12H8FeO-6 |
| Molecular Weight | 224.04 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanone;iron |
| SMILES | CC(=O)[c-]1cccc1.[Fe].[c-]1[c-][c-][cH-][c-]1 |
| InChI | InChI=1S/C7H7O.C5H.Fe/c1-6(8)7-4-2-3-5-7;1-2-4-5-3-1;/h2-5H,1H3;1H;/q-1;-5; |
| InChIKey | ZDDGVIVIYYQJHA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.04 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanone;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanone;iron?
The IUPAC name of cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanone;iron (CID 11985923) is cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanone;iron.
What is the SMILES notation for cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanone;iron?
The canonical SMILES for cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanone;iron is CC(=O)[c-]1cccc1.[Fe].[c-]1[c-][c-][cH-][c-]1.
What is the InChIKey of cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanone;iron?
The InChIKey is ZDDGVIVIYYQJHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7O.C5H.Fe/c1-6(8)7-4-2-3-5-7;1-2-4-5-3-1;/h2-5H,1H3;1H;/q-1;-5;.
What are the key properties of cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanone;iron?
cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanone;iron has a molecular weight of 224.04 g/mol, XLogP of 2.21, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylethanone;iron is sourced from PubChem (CID 11985923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).