C14H19Cl2N3OS — CID 119859279
2-(4-aminophenyl)-N-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide;dihydrochloride (PubChem CID 119859279) has the molecular formula C14H19Cl2N3OS and a molecular weight of 348.30 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119859279 |
| Molecular Formula | C14H19Cl2N3OS |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-(4-aminophenyl)-N-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]acetamide;dihydrochloride |
| SMILES | Cc1ncc(CN(C)C(=O)Cc2ccc(N)cc2)s1.Cl.Cl |
| InChI | InChI=1S/C14H17N3OS.2ClH/c1-10-16-8-13(19-10)9-17(2)14(18)7-11-3-5-12(15)6-4-11;;/h3-6,8H,7,9,15H2,1-2H3;2*1H |
| InChIKey | AGFBTXOSASIJPD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|