C30H48Cr-6 — CID 11985997
chromium;1,3,5-tri(propan-2-yl)benzene;1,3,5-tri(propan-2-yl)cyclohexane (PubChem CID 11985997) has the molecular formula C30H48Cr-6 and a molecular weight of 460.71 g/mol. Its IUPAC name is chromium;1,3,5-tri(propan-2-yl)benzene;1,3,5-tri(propan-2-yl)cyclohexane.
| Compound Name | chromium;1,3,5-tri(propan-2-yl)benzene;1,3,5-tri(propan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 11985997 |
| Molecular Formula | C30H48Cr-6 |
| Molecular Weight | 460.71 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | chromium;1,3,5-tri(propan-2-yl)benzene;1,3,5-tri(propan-2-yl)cyclohexane |
| SMILES | CC(C)[C-]1[CH-][C-](C(C)C)[CH-][C-](C(C)C)[CH-]1.CC(C)c1cc(C(C)C)cc(C(C)C)c1.[Cr] |
| InChI | InChI=1S/2C15H24.Cr/c2*1-10(2)13-7-14(11(3)4)9-15(8-13)12(5)6;/h2*7-12H,1-6H3;/q;-6; |
| InChIKey | RNGOGLTZASXXTH-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.71 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|