About 5-tert-butyl-1,2,3,4-tetramethylcyclopenta-1,3-diene
5-tert-butyl-1,2,3,4-tetramethylcyclopenta-1,3-diene (PubChem CID 11986068) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is 5-tert-butyl-1,2,3,4-tetramethylcyclopenta-1,3-diene.
Analyze 5-tert-butyl-1,2,3,4-tetramethylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-1,2,3,4-tetramethylcyclopenta-1,3-diene?
The IUPAC name of 5-tert-butyl-1,2,3,4-tetramethylcyclopenta-1,3-diene (CID 11986068) is 5-tert-butyl-1,2,3,4-tetramethylcyclopenta-1,3-diene.
What is the SMILES notation for 5-tert-butyl-1,2,3,4-tetramethylcyclopenta-1,3-diene?
The canonical SMILES for 5-tert-butyl-1,2,3,4-tetramethylcyclopenta-1,3-diene is CC1=C(C)C(C(C)(C)C)C(C)=C1C.
What is the InChIKey of 5-tert-butyl-1,2,3,4-tetramethylcyclopenta-1,3-diene?
The InChIKey is GITVKFHHZYTGGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22/c1-8-9(2)11(4)12(10(8)3)13(5,6)7/h12H,1-7H3.
What are the key properties of 5-tert-butyl-1,2,3,4-tetramethylcyclopenta-1,3-diene?
5-tert-butyl-1,2,3,4-tetramethylcyclopenta-1,3-diene has a molecular weight of 178.32 g/mol, XLogP of 4.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-1,2,3,4-tetramethylcyclopenta-1,3-diene is sourced from PubChem (CID 11986068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).