C18H22Cl2N4O2 — CID 119861037
N-[3-[(pyrrolidine-3-carbonylamino)methyl]phenyl]pyridine-4-carboxamide;dihydrochloride (PubChem CID 119861037) has the molecular formula C18H22Cl2N4O2 and a molecular weight of 397.31 g/mol. Its IUPAC name is N-[3-[(pyrrolidine-3-carbonylamino)methyl]phenyl]pyridine-4-carboxamide;dihydrochloride.
| Compound Name | N-[3-[(pyrrolidine-3-carbonylamino)methyl]phenyl]pyridine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119861037 |
| Molecular Formula | C18H22Cl2N4O2 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[3-[(pyrrolidine-3-carbonylamino)methyl]phenyl]pyridine-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1cccc(CNC(=O)C2CCNC2)c1)c1ccncc1 |
| InChI | InChI=1S/C18H20N4O2.2ClH/c23-17(15-6-9-20-12-15)21-11-13-2-1-3-16(10-13)22-18(24)14-4-7-19-8-5-14;;/h1-5,7-8,10,15,20H,6,9,11-12H2,(H,21,23)(H,22,24);2*1H |
| InChIKey | DXYMZCVSGUEZNI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |