C18H37Cl2N3O — CID 119861221
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(dipropylamino)propyl]acetamide;dihydrochloride (PubChem CID 119861221) has the molecular formula C18H37Cl2N3O and a molecular weight of 382.42 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(dipropylamino)propyl]acetamide;dihydrochloride.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(dipropylamino)propyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119861221 |
| Molecular Formula | C18H37Cl2N3O |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(dipropylamino)propyl]acetamide;dihydrochloride |
| SMILES | CCCN(CCC)CCCNC(=O)CC1CC2CCC(C1)N2.Cl.Cl |
| InChI | InChI=1S/C18H35N3O.2ClH/c1-3-9-21(10-4-2)11-5-8-19-18(22)14-15-12-16-6-7-17(13-15)20-16;;/h15-17,20H,3-14H2,1-2H3,(H,19,22);2*1H |
| InChIKey | FQLXFGOZUNEXDR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|