C18H26FN3O — CID 119862617
3-amino-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]cyclohexane-1-carboxamide (PubChem CID 119862617) has the molecular formula C18H26FN3O and a molecular weight of 319.42 g/mol. Its IUPAC name is 3-amino-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119862617 |
| Molecular Formula | C18H26FN3O |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 3-amino-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]cyclohexane-1-carboxamide |
| SMILES | NC1CCCC(C(=O)NCC2CCN(c3ccc(F)cc3)C2)C1 |
| InChI | InChI=1S/C18H26FN3O/c19-15-4-6-17(7-5-15)22-9-8-13(12-22)11-21-18(23)14-2-1-3-16(20)10-14/h4-7,13-14,16H,1-3,8-12,20H2,(H,21,23) |
| InChIKey | JJTBZHWOXPFCBA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |