C13H24N4O3 — CID 119863890
N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]pyrrolidine-2-carboxamide (PubChem CID 119863890) has the molecular formula C13H24N4O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119863890 |
| Molecular Formula | C13H24N4O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(CNC(=O)C1CCCN1)NCCN1CCOCC1 |
| InChI | InChI=1S/C13H24N4O3/c18-12(10-16-13(19)11-2-1-3-14-11)15-4-5-17-6-8-20-9-7-17/h11,14H,1-10H2,(H,15,18)(H,16,19) |
| InChIKey | YQUBYZDGXZHDKG-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |