C17H20Cl3N3O2 — CID 119864102
N-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]piperidine-4-carboxamide;dihydrochloride (PubChem CID 119864102) has the molecular formula C17H20Cl3N3O2 and a molecular weight of 404.73 g/mol. Its IUPAC name is N-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]piperidine-4-carboxamide;dihydrochloride.
| Compound Name | N-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]piperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119864102 |
| Molecular Formula | C17H20Cl3N3O2 |
| Molecular Weight | 404.73 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | N-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]piperidine-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1ccc(Oc2ccc(Cl)cn2)cc1)C1CCNCC1 |
| InChI | InChI=1S/C17H18ClN3O2.2ClH/c18-13-1-6-16(20-11-13)23-15-4-2-14(3-5-15)21-17(22)12-7-9-19-10-8-12;;/h1-6,11-12,19H,7-10H2,(H,21,22);2*1H |
| InChIKey | LEKQRJDWTDPQRY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.73 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |