C14H24Cl2N4O3S — CID 119864412
2-amino-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]propanamide;dihydrochloride (PubChem CID 119864412) has the molecular formula C14H24Cl2N4O3S and a molecular weight of 399.34 g/mol. Its IUPAC name is 2-amino-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]propanamide;dihydrochloride.
| Compound Name | 2-amino-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119864412 |
| Molecular Formula | C14H24Cl2N4O3S |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-amino-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]propanamide;dihydrochloride |
| SMILES | CC(N)C(=O)Nc1cccc(S(=O)(=O)N2CCN(C)CC2)c1.Cl.Cl |
| InChI | InChI=1S/C14H22N4O3S.2ClH/c1-11(15)14(19)16-12-4-3-5-13(10-12)22(20,21)18-8-6-17(2)7-9-18;;/h3-5,10-11H,6-9,15H2,1-2H3,(H,16,19);2*1H |
| InChIKey | RZUHPVBSRZWKAR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |