C18H23Cl2N3O2 — CID 119864481
1-amino-N-(3-methyl-4-pyridin-3-yloxyphenyl)cyclopentane-1-carboxamide;dihydrochloride (PubChem CID 119864481) has the molecular formula C18H23Cl2N3O2 and a molecular weight of 384.31 g/mol. Its IUPAC name is 1-amino-N-(3-methyl-4-pyridin-3-yloxyphenyl)cyclopentane-1-carboxamide;dihydrochloride.
| Compound Name | 1-amino-N-(3-methyl-4-pyridin-3-yloxyphenyl)cyclopentane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119864481 |
| Molecular Formula | C18H23Cl2N3O2 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 1-amino-N-(3-methyl-4-pyridin-3-yloxyphenyl)cyclopentane-1-carboxamide;dihydrochloride |
| SMILES | Cc1cc(NC(=O)C2(N)CCCC2)ccc1Oc1cccnc1.Cl.Cl |
| InChI | InChI=1S/C18H21N3O2.2ClH/c1-13-11-14(21-17(22)18(19)8-2-3-9-18)6-7-16(13)23-15-5-4-10-20-12-15;;/h4-7,10-12H,2-3,8-9,19H2,1H3,(H,21,22);2*1H |
| InChIKey | NAVZRWLMHSNSOW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |