C22H30Cl2N4O3 — CID 119865080
4-[(2-amino-3-phenylpropanoyl)amino]-N-(2-morpholin-4-ylethyl)benzamide;dihydrochloride (PubChem CID 119865080) has the molecular formula C22H30Cl2N4O3 and a molecular weight of 469.41 g/mol. Its IUPAC name is 4-[(2-amino-3-phenylpropanoyl)amino]-N-(2-morpholin-4-ylethyl)benzamide;dihydrochloride.
| Compound Name | 4-[(2-amino-3-phenylpropanoyl)amino]-N-(2-morpholin-4-ylethyl)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119865080 |
| Molecular Formula | C22H30Cl2N4O3 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 4-[(2-amino-3-phenylpropanoyl)amino]-N-(2-morpholin-4-ylethyl)benzamide;dihydrochloride |
| SMILES | Cl.Cl.NC(Cc1ccccc1)C(=O)Nc1ccc(C(=O)NCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C22H28N4O3.2ClH/c23-20(16-17-4-2-1-3-5-17)22(28)25-19-8-6-18(7-9-19)21(27)24-10-11-26-12-14-29-15-13-26;;/h1-9,20H,10-16,23H2,(H,24,27)(H,25,28);2*1H |
| InChIKey | CUIVOBCQGYOCRZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |