C17H29Cl2N3O3 — CID 119865260
3-amino-N-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]butanamide;dihydrochloride (PubChem CID 119865260) has the molecular formula C17H29Cl2N3O3 and a molecular weight of 394.34 g/mol. Its IUPAC name is 3-amino-N-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]butanamide;dihydrochloride.
| Compound Name | 3-amino-N-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119865260 |
| Molecular Formula | C17H29Cl2N3O3 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 3-amino-N-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]butanamide;dihydrochloride |
| SMILES | CC(N)CC(=O)NCc1ccccc1OCCN1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C17H27N3O3.2ClH/c1-14(18)12-17(21)19-13-15-4-2-3-5-16(15)23-11-8-20-6-9-22-10-7-20;;/h2-5,14H,6-13,18H2,1H3,(H,19,21);2*1H |
| InChIKey | PGQXWHCOUNVBTI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |