C22H29N3O — CID 119867241
2-amino-N-[[4-(azepan-1-ylmethyl)phenyl]methyl]-2-phenylacetamide (PubChem CID 119867241) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-amino-N-[[4-(azepan-1-ylmethyl)phenyl]methyl]-2-phenylacetamide.
| Compound Name | 2-amino-N-[[4-(azepan-1-ylmethyl)phenyl]methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 119867241 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 2-amino-N-[[4-(azepan-1-ylmethyl)phenyl]methyl]-2-phenylacetamide |
| SMILES | NC(C(=O)NCc1ccc(CN2CCCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O/c23-21(20-8-4-3-5-9-20)22(26)24-16-18-10-12-19(13-11-18)17-25-14-6-1-2-7-15-25/h3-5,8-13,21H,1-2,6-7,14-17,23H2,(H,24,26) |
| InChIKey | JEDSZCFXFVSHME-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |