C21H35Cl2N3O — CID 119867290
1-amino-N-[[4-(azepan-1-ylmethyl)phenyl]methyl]cyclohexane-1-carboxamide;dihydrochloride (PubChem CID 119867290) has the molecular formula C21H35Cl2N3O and a molecular weight of 416.44 g/mol. Its IUPAC name is 1-amino-N-[[4-(azepan-1-ylmethyl)phenyl]methyl]cyclohexane-1-carboxamide;dihydrochloride.
| Compound Name | 1-amino-N-[[4-(azepan-1-ylmethyl)phenyl]methyl]cyclohexane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119867290 |
| Molecular Formula | C21H35Cl2N3O |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1-amino-N-[[4-(azepan-1-ylmethyl)phenyl]methyl]cyclohexane-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC1(C(=O)NCc2ccc(CN3CCCCCC3)cc2)CCCCC1 |
| InChI | InChI=1S/C21H33N3O.2ClH/c22-21(12-4-3-5-13-21)20(25)23-16-18-8-10-19(11-9-18)17-24-14-6-1-2-7-15-24;;/h8-11H,1-7,12-17,22H2,(H,23,25);2*1H |
| InChIKey | PNENYWHFNULQLJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |